C15H18O5 — CID 139828832
(10-acetyloxy-11-oxatetracyclo[6.2.1.13,6.02,7]dodec-4-en-9-yl) acetate (PubChem CID 139828832) has the molecular formula C15H18O5 and a molecular weight of 278.30 g/mol. Its IUPAC name is (10-acetyloxy-11-oxatetracyclo[6.2.1.13,6.02,7]dodec-4-en-9-yl) acetate.
| Compound Name | (10-acetyloxy-11-oxatetracyclo[6.2.1.13,6.02,7]dodec-4-en-9-yl) acetate |
|---|---|
| PubChem CID | 139828832 |
| Molecular Formula | C15H18O5 |
| Molecular Weight | 278.30 g/mol |
| Exact Mass | 278.12 |
| IUPAC Name | (10-acetyloxy-11-oxatetracyclo[6.2.1.13,6.02,7]dodec-4-en-9-yl) acetate |
| SMILES | CC(=O)OC1C(OC(C)=O)C2OC1C1C3C=CC(C3)C21 |
| InChI | InChI=1S/C15H18O5/c1-6(16)18-14-12-10-8-3-4-9(5-8)11(10)13(20-12)15(14)19-7(2)17/h3-4,8-15H,5H2,1-2H3 |
| InChIKey | NNISQAYHYQKRFW-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.30 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|