C8H14O6 — CID 70946424
[(2R,3R,4R,6R)-3,4,6-trihydroxyoxan-2-yl]methyl acetate (PubChem CID 70946424) has the molecular formula C8H14O6 and a molecular weight of 206.19 g/mol. Its IUPAC name is [(2R,3R,4R,6R)-3,4,6-trihydroxyoxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4R,6R)-3,4,6-trihydroxyoxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 70946424 |
| Molecular Formula | C8H14O6 |
| Molecular Weight | 206.19 g/mol |
| Exact Mass | 206.08 |
| IUPAC Name | [(2R,3R,4R,6R)-3,4,6-trihydroxyoxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](O)C[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C8H14O6/c1-4(9)13-3-6-8(12)5(10)2-7(11)14-6/h5-8,10-12H,2-3H2,1H3/t5-,6-,7-,8-/m1/s1 |
| InChIKey | RKYHWTASLGKHDB-WCTZXXKLSA-N |
| XLogP | -1.62 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.19 |
| LogP ≤ 5 | -1.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |