C7H12O5 — CID 130353302
[(2R,3R,4S)-3,4-dihydroxyoxolan-2-yl]methyl acetate (PubChem CID 130353302) has the molecular formula C7H12O5 and a molecular weight of 176.17 g/mol. Its IUPAC name is [(2R,3R,4S)-3,4-dihydroxyoxolan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4S)-3,4-dihydroxyoxolan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 130353302 |
| Molecular Formula | C7H12O5 |
| Molecular Weight | 176.17 g/mol |
| Exact Mass | 176.07 |
| IUPAC Name | [(2R,3R,4S)-3,4-dihydroxyoxolan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1OC[C@H](O)[C@H]1O |
| InChI | InChI=1S/C7H12O5/c1-4(8)11-3-6-7(10)5(9)2-12-6/h5-7,9-10H,2-3H2,1H3/t5-,6+,7+/m0/s1 |
| InChIKey | UBRQOZHGEPZAGZ-RRKCRQDMSA-N |
| XLogP | -1.33 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.17 |
| LogP ≤ 5 | -1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |