About [5-(acetyloxymethyl)-1,3-dioxolan-4-yl]methyl acetate
[5-(acetyloxymethyl)-1,3-dioxolan-4-yl]methyl acetate (PubChem CID 14157591) has the molecular formula C9H14O6
and a molecular weight of 218.20 g/mol. Its IUPAC name is [5-(acetyloxymethyl)-1,3-dioxolan-4-yl]methyl acetate.
Analyze [5-(acetyloxymethyl)-1,3-dioxolan-4-yl]methyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-(acetyloxymethyl)-1,3-dioxolan-4-yl]methyl acetate?
The IUPAC name of [5-(acetyloxymethyl)-1,3-dioxolan-4-yl]methyl acetate (CID 14157591) is [5-(acetyloxymethyl)-1,3-dioxolan-4-yl]methyl acetate.
What is the SMILES notation for [5-(acetyloxymethyl)-1,3-dioxolan-4-yl]methyl acetate?
The canonical SMILES for [5-(acetyloxymethyl)-1,3-dioxolan-4-yl]methyl acetate is CC(=O)OCC1OCOC1COC(C)=O.
What is the InChIKey of [5-(acetyloxymethyl)-1,3-dioxolan-4-yl]methyl acetate?
The InChIKey is DUMXKXJCNMEPQX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14O6/c1-6(10)12-3-8-9(15-5-14-8)4-13-7(2)11/h8-9H,3-5H2,1-2H3.
What are the key properties of [5-(acetyloxymethyl)-1,3-dioxolan-4-yl]methyl acetate?
[5-(acetyloxymethyl)-1,3-dioxolan-4-yl]methyl acetate has a molecular weight of 218.20 g/mol, XLogP of -0.15, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [5-(acetyloxymethyl)-1,3-dioxolan-4-yl]methyl acetate is sourced from PubChem (CID 14157591), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).