C6H10O4 — CID 11062516
[(2R,3S)-3-(hydroxymethyl)oxiran-2-yl]methyl acetate (PubChem CID 11062516) has the molecular formula C6H10O4 and a molecular weight of 146.14 g/mol. Its IUPAC name is [(2R,3S)-3-(hydroxymethyl)oxiran-2-yl]methyl acetate.
| Compound Name | [(2R,3S)-3-(hydroxymethyl)oxiran-2-yl]methyl acetate |
|---|---|
| PubChem CID | 11062516 |
| Molecular Formula | C6H10O4 |
| Molecular Weight | 146.14 g/mol |
| Exact Mass | 146.06 |
| IUPAC Name | [(2R,3S)-3-(hydroxymethyl)oxiran-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@H]1CO |
| InChI | InChI=1S/C6H10O4/c1-4(8)9-3-6-5(2-7)10-6/h5-7H,2-3H2,1H3/t5-,6+/m0/s1 |
| InChIKey | AYJWJMIDRWEONW-NTSWFWBYSA-N |
| XLogP | -0.69 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 146.14 |
| LogP ≤ 5 | -0.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|