C11H20O5 — CID 129219584
[(2R,3R,4R)-3,4-dihydroxyoxolan-2-yl]methyl hexanoate (PubChem CID 129219584) has the molecular formula C11H20O5 and a molecular weight of 232.28 g/mol. Its IUPAC name is [(2R,3R,4R)-3,4-dihydroxyoxolan-2-yl]methyl hexanoate.
| Compound Name | [(2R,3R,4R)-3,4-dihydroxyoxolan-2-yl]methyl hexanoate |
|---|---|
| PubChem CID | 129219584 |
| Molecular Formula | C11H20O5 |
| Molecular Weight | 232.28 g/mol |
| Exact Mass | 232.13 |
| IUPAC Name | [(2R,3R,4R)-3,4-dihydroxyoxolan-2-yl]methyl hexanoate |
| SMILES | CCCCCC(=O)OC[C@H]1OC[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C11H20O5/c1-2-3-4-5-10(13)16-7-9-11(14)8(12)6-15-9/h8-9,11-12,14H,2-7H2,1H3/t8-,9-,11-/m1/s1 |
| InChIKey | IETLKTVUXSXPRP-FXPVBKGRSA-N |
| XLogP | 0.23 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.28 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|