C11H20O5 — CID 166756181
(3,4-dihydroxy-6-propyloxan-2-yl)methyl acetate (PubChem CID 166756181) has the molecular formula C11H20O5 and a molecular weight of 232.28 g/mol. Its IUPAC name is (3,4-dihydroxy-6-propyloxan-2-yl)methyl acetate.
| Compound Name | (3,4-dihydroxy-6-propyloxan-2-yl)methyl acetate |
|---|---|
| PubChem CID | 166756181 |
| Molecular Formula | C11H20O5 |
| Molecular Weight | 232.28 g/mol |
| Exact Mass | 232.13 |
| IUPAC Name | (3,4-dihydroxy-6-propyloxan-2-yl)methyl acetate |
| SMILES | CCCC1CC(O)C(O)C(COC(C)=O)O1 |
| InChI | InChI=1S/C11H20O5/c1-3-4-8-5-9(13)11(14)10(16-8)6-15-7(2)12/h8-11,13-14H,3-6H2,1-2H3 |
| InChIKey | KSABMJXHUOWRQY-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.28 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |