C10H18O7 — CID 15742207
[(2R,3S,4S,5R)-6-ethoxy-3,4,5-trihydroxyoxan-2-yl]methyl acetate (PubChem CID 15742207) has the molecular formula C10H18O7 and a molecular weight of 250.25 g/mol. Its IUPAC name is [(2R,3S,4S,5R)-6-ethoxy-3,4,5-trihydroxyoxan-2-yl]methyl acetate.
| Compound Name | [(2R,3S,4S,5R)-6-ethoxy-3,4,5-trihydroxyoxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 15742207 |
| Molecular Formula | C10H18O7 |
| Molecular Weight | 250.25 g/mol |
| Exact Mass | 250.11 |
| IUPAC Name | [(2R,3S,4S,5R)-6-ethoxy-3,4,5-trihydroxyoxan-2-yl]methyl acetate |
| SMILES | CCOC1O[C@H](COC(C)=O)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C10H18O7/c1-3-15-10-9(14)8(13)7(12)6(17-10)4-16-5(2)11/h6-10,12-14H,3-4H2,1-2H3/t6-,7-,8+,9-,10?/m1/s1 |
| InChIKey | KKEQRRUMLIRLID-ZKZCYXTQSA-N |
| XLogP | -1.61 |
| TPSA | 105.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.25 |
| LogP ≤ 5 | -1.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |