C10H16O8 — CID 121290489
[(3R,5S)-6-acetyloxy-3,4,5-trihydroxyoxan-2-yl]methyl acetate (PubChem CID 121290489) has the molecular formula C10H16O8 and a molecular weight of 264.23 g/mol. Its IUPAC name is [(3R,5S)-6-acetyloxy-3,4,5-trihydroxyoxan-2-yl]methyl acetate.
| Compound Name | [(3R,5S)-6-acetyloxy-3,4,5-trihydroxyoxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 121290489 |
| Molecular Formula | C10H16O8 |
| Molecular Weight | 264.23 g/mol |
| Exact Mass | 264.08 |
| IUPAC Name | [(3R,5S)-6-acetyloxy-3,4,5-trihydroxyoxan-2-yl]methyl acetate |
| SMILES | CC(=O)OCC1OC(OC(C)=O)[C@@H](O)C(O)[C@H]1O |
| InChI | InChI=1S/C10H16O8/c1-4(11)16-3-6-7(13)8(14)9(15)10(18-6)17-5(2)12/h6-10,13-15H,3H2,1-2H3/t6?,7-,8?,9-,10?/m0/s1 |
| InChIKey | NIKIBKZQSQUVOS-IHELMQQZSA-N |
| XLogP | -2.08 |
| TPSA | 122.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.23 |
| LogP ≤ 5 | -2.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |