C13H24O7 — CID 141343493
[(2R,3R,4S,5R,6S)-5-butoxy-3,6-dihydroxy-4-methoxyoxan-2-yl]methyl acetate (PubChem CID 141343493) has the molecular formula C13H24O7 and a molecular weight of 292.33 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6S)-5-butoxy-3,6-dihydroxy-4-methoxyoxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4S,5R,6S)-5-butoxy-3,6-dihydroxy-4-methoxyoxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 141343493 |
| Molecular Formula | C13H24O7 |
| Molecular Weight | 292.33 g/mol |
| Exact Mass | 292.15 |
| IUPAC Name | [(2R,3R,4S,5R,6S)-5-butoxy-3,6-dihydroxy-4-methoxyoxan-2-yl]methyl acetate |
| SMILES | CCCCO[C@@H]1[C@@H](OC)[C@H](O)[C@@H](COC(C)=O)O[C@@H]1O |
| InChI | InChI=1S/C13H24O7/c1-4-5-6-18-12-11(17-3)10(15)9(20-13(12)16)7-19-8(2)14/h9-13,15-16H,4-7H2,1-3H3/t9-,10-,11+,12-,13+/m1/s1 |
| InChIKey | XUUAUMNKCOLKBV-LBELIVKGSA-N |
| XLogP | -0.17 |
| TPSA | 94.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.33 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|