C8H11F3O7S — CID 88884440
[(2R,3S,5S)-5-hydroxy-3-(trifluoromethylsulfonyloxy)oxolan-2-yl]methyl acetate (PubChem CID 88884440) has the molecular formula C8H11F3O7S and a molecular weight of 308.23 g/mol. Its IUPAC name is [(2R,3S,5S)-5-hydroxy-3-(trifluoromethylsulfonyloxy)oxolan-2-yl]methyl acetate.
| Compound Name | [(2R,3S,5S)-5-hydroxy-3-(trifluoromethylsulfonyloxy)oxolan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 88884440 |
| Molecular Formula | C8H11F3O7S |
| Molecular Weight | 308.23 g/mol |
| Exact Mass | 308.02 |
| IUPAC Name | [(2R,3S,5S)-5-hydroxy-3-(trifluoromethylsulfonyloxy)oxolan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@H](O)C[C@@H]1OS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C8H11F3O7S/c1-4(12)16-3-6-5(2-7(13)17-6)18-19(14,15)8(9,10)11/h5-7,13H,2-3H2,1H3/t5-,6+,7-/m0/s1 |
| InChIKey | QQCSKXUVZGEOHY-XVMARJQXSA-N |
| XLogP | -0.11 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.23 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|