C13H19F3O7S — CID 134867358
[(3aR,4R,6S,6aS)-2,2,3a-trimethyl-6-(trifluoromethylsulfonyloxy)-4,5,6,6a-tetrahydrocyclopenta[d][1,3]dioxol-4-yl]methyl acetate (PubChem CID 134867358) has the molecular formula C13H19F3O7S and a molecular weight of 376.35 g/mol. Its IUPAC name is [(3aR,4R,6S,6aS)-2,2,3a-trimethyl-6-(trifluoromethylsulfonyloxy)-4,5,6,6a-tetrahydrocyclopenta[d][1,3]dioxol-4-yl]methyl acetate.
| Compound Name | [(3aR,4R,6S,6aS)-2,2,3a-trimethyl-6-(trifluoromethylsulfonyloxy)-4,5,6,6a-tetrahydrocyclopenta[d][1,3]dioxol-4-yl]methyl acetate |
|---|---|
| PubChem CID | 134867358 |
| Molecular Formula | C13H19F3O7S |
| Molecular Weight | 376.35 g/mol |
| Exact Mass | 376.08 |
| IUPAC Name | [(3aR,4R,6S,6aS)-2,2,3a-trimethyl-6-(trifluoromethylsulfonyloxy)-4,5,6,6a-tetrahydrocyclopenta[d][1,3]dioxol-4-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1C[C@H](OS(=O)(=O)C(F)(F)F)[C@@H]2OC(C)(C)O[C@]12C |
| InChI | InChI=1S/C13H19F3O7S/c1-7(17)20-6-8-5-9(22-24(18,19)13(14,15)16)10-12(8,4)23-11(2,3)21-10/h8-10H,5-6H2,1-4H3/t8-,9+,10+,12-/m1/s1 |
| InChIKey | UZXIVZJWVSNJPN-FYLLDIAZSA-N |
| XLogP | 1.71 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.35 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|