C12H17F3O7S — CID 102392360
[(3aR,4S,6S,6aS)-2,2,3a-trimethyl-6-(trifluoromethylsulfonyloxy)-4,5,6,6a-tetrahydrocyclopenta[d][1,3]dioxol-4-yl] acetate (PubChem CID 102392360) has the molecular formula C12H17F3O7S and a molecular weight of 362.32 g/mol. Its IUPAC name is [(3aR,4S,6S,6aS)-2,2,3a-trimethyl-6-(trifluoromethylsulfonyloxy)-4,5,6,6a-tetrahydrocyclopenta[d][1,3]dioxol-4-yl] acetate.
| Compound Name | [(3aR,4S,6S,6aS)-2,2,3a-trimethyl-6-(trifluoromethylsulfonyloxy)-4,5,6,6a-tetrahydrocyclopenta[d][1,3]dioxol-4-yl] acetate |
|---|---|
| PubChem CID | 102392360 |
| Molecular Formula | C12H17F3O7S |
| Molecular Weight | 362.32 g/mol |
| Exact Mass | 362.06 |
| IUPAC Name | [(3aR,4S,6S,6aS)-2,2,3a-trimethyl-6-(trifluoromethylsulfonyloxy)-4,5,6,6a-tetrahydrocyclopenta[d][1,3]dioxol-4-yl] acetate |
| SMILES | CC(=O)O[C@H]1C[C@H](OS(=O)(=O)C(F)(F)F)[C@@H]2OC(C)(C)O[C@]12C |
| InChI | InChI=1S/C12H17F3O7S/c1-6(16)19-8-5-7(21-23(17,18)12(13,14)15)9-11(8,4)22-10(2,3)20-9/h7-9H,5H2,1-4H3/t7-,8-,9-,11+/m0/s1 |
| InChIKey | IZYYCBIEQHGPEW-FTYOSLGDSA-N |
| XLogP | 1.47 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.32 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|