About [2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-oxoethyl] trifluoromethanesulfonate
[2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-oxoethyl] trifluoromethanesulfonate (PubChem CID 100943789) has the molecular formula C8H11F3O6S
and a molecular weight of 292.23 g/mol. Its IUPAC name is [2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-oxoethyl] trifluoromethanesulfonate.
Molecular Properties
| Compound Name | [2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-oxoethyl] trifluoromethanesulfonate |
| PubChem CID | 100943789 |
| Molecular Formula | C8H11F3O6S |
| Molecular Weight | 292.23 g/mol |
| Exact Mass | 292.02 |
| IUPAC Name | [2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-oxoethyl] trifluoromethanesulfonate |
| SMILES | CC1(C)OC[C@@H](C(=O)COS(=O)(=O)C(F)(F)F)O1 |
| InChI | InChI=1S/C8H11F3O6S/c1-7(2)15-4-6(17-7)5(12)3-16-18(13,14)8(9,10)11/h6H,3-4H2,1-2H3/t6-/m0/s1 |
| InChIKey | UAGRJODBRMHITG-LURJTMIESA-N |
| XLogP | 0.57 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.23 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze [2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-oxoethyl] trifluoromethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-oxoethyl] trifluoromethanesulfonate?
The IUPAC name of [2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-oxoethyl] trifluoromethanesulfonate (CID 100943789) is [2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-oxoethyl] trifluoromethanesulfonate.
What is the SMILES notation for [2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-oxoethyl] trifluoromethanesulfonate?
The canonical SMILES for [2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-oxoethyl] trifluoromethanesulfonate is CC1(C)OC[C@@H](C(=O)COS(=O)(=O)C(F)(F)F)O1.
What is the InChIKey of [2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-oxoethyl] trifluoromethanesulfonate?
The InChIKey is UAGRJODBRMHITG-LURJTMIESA-N. The full InChI is InChI=1S/C8H11F3O6S/c1-7(2)15-4-6(17-7)5(12)3-16-18(13,14)8(9,10)11/h6H,3-4H2,1-2H3/t6-/m0/s1.
What are the key properties of [2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-oxoethyl] trifluoromethanesulfonate?
[2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-oxoethyl] trifluoromethanesulfonate has a molecular weight of 292.23 g/mol, XLogP of 0.57, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-oxoethyl] trifluoromethanesulfonate is sourced from PubChem (CID 100943789), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).