C8H13F3O5S — CID 59158516
2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]ethyl trifluoromethanesulfonate (PubChem CID 59158516) has the molecular formula C8H13F3O5S and a molecular weight of 278.25 g/mol. Its IUPAC name is 2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]ethyl trifluoromethanesulfonate.
| Compound Name | 2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]ethyl trifluoromethanesulfonate |
|---|---|
| PubChem CID | 59158516 |
| Molecular Formula | C8H13F3O5S |
| Molecular Weight | 278.25 g/mol |
| Exact Mass | 278.04 |
| IUPAC Name | 2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]ethyl trifluoromethanesulfonate |
| SMILES | CC1(C)OC[C@H](CCOS(=O)(=O)C(F)(F)F)O1 |
| InChI | InChI=1S/C8H13F3O5S/c1-7(2)14-5-6(16-7)3-4-15-17(12,13)8(9,10)11/h6H,3-5H2,1-2H3/t6-/m0/s1 |
| InChIKey | CWFOKHSKYPNTTM-LURJTMIESA-N |
| XLogP | 1.39 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.25 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|