C9H11F9O10S3 — CID 157243709
(2,2-dimethyl-1,3-dioxolan-4-yl)methyl trifluoromethanesulfonate;trifluoromethylsulfonyl trifluoromethanesulfonate (PubChem CID 157243709) has the molecular formula C9H11F9O10S3 and a molecular weight of 546.36 g/mol. Its IUPAC name is (2,2-dimethyl-1,3-dioxolan-4-yl)methyl trifluoromethanesulfonate;trifluoromethylsulfonyl trifluoromethanesulfonate.
| Compound Name | (2,2-dimethyl-1,3-dioxolan-4-yl)methyl trifluoromethanesulfonate;trifluoromethylsulfonyl trifluoromethanesulfonate |
|---|---|
| PubChem CID | 157243709 |
| Molecular Formula | C9H11F9O10S3 |
| Molecular Weight | 546.36 g/mol |
| Exact Mass | 545.94 |
| IUPAC Name | (2,2-dimethyl-1,3-dioxolan-4-yl)methyl trifluoromethanesulfonate;trifluoromethylsulfonyl trifluoromethanesulfonate |
| SMILES | CC1(C)OCC(COS(=O)(=O)C(F)(F)F)O1.O=S(=O)(OS(=O)(=O)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C7H11F3O5S.C2F6O5S2/c1-6(2)13-3-5(15-6)4-14-16(11,12)7(8,9)10;3-1(4,5)14(9,10)13-15(11,12)2(6,7)8/h5H,3-4H2,1-2H3; |
| InChIKey | AVMVFMBREMYSBI-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 139.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.36 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|