C7H14O3S — CID 126562588
2,2-dimethyl-4-(methylsulfanyloxymethyl)-1,3-dioxolane (PubChem CID 126562588) has the molecular formula C7H14O3S and a molecular weight of 178.25 g/mol. Its IUPAC name is 2,2-dimethyl-4-(methylsulfanyloxymethyl)-1,3-dioxolane.
| Compound Name | 2,2-dimethyl-4-(methylsulfanyloxymethyl)-1,3-dioxolane |
|---|---|
| PubChem CID | 126562588 |
| Molecular Formula | C7H14O3S |
| Molecular Weight | 178.25 g/mol |
| Exact Mass | 178.07 |
| IUPAC Name | 2,2-dimethyl-4-(methylsulfanyloxymethyl)-1,3-dioxolane |
| SMILES | CSOCC1COC(C)(C)O1 |
| InChI | InChI=1S/C7H14O3S/c1-7(2)8-4-6(10-7)5-9-11-3/h6H,4-5H2,1-3H3 |
| InChIKey | CWQKAFNMOAJYDI-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.25 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|