C9H18O4 — CID 57158294
(4S)-4-(2-methoxyethoxymethyl)-2,2-dimethyl-1,3-dioxolane (PubChem CID 57158294) has the molecular formula C9H18O4 and a molecular weight of 190.24 g/mol. Its IUPAC name is (4S)-4-(2-methoxyethoxymethyl)-2,2-dimethyl-1,3-dioxolane.
| Compound Name | (4S)-4-(2-methoxyethoxymethyl)-2,2-dimethyl-1,3-dioxolane |
|---|---|
| PubChem CID | 57158294 |
| Molecular Formula | C9H18O4 |
| Molecular Weight | 190.24 g/mol |
| Exact Mass | 190.12 |
| IUPAC Name | (4S)-4-(2-methoxyethoxymethyl)-2,2-dimethyl-1,3-dioxolane |
| SMILES | COCCOC[C@H]1COC(C)(C)O1 |
| InChI | InChI=1S/C9H18O4/c1-9(2)12-7-8(13-9)6-11-5-4-10-3/h8H,4-7H2,1-3H3/t8-/m0/s1 |
| InChIKey | CSQYCGUUGAHEGR-QMMMGPOBSA-N |
| XLogP | 0.80 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.24 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|