About (4R)-2,2-dimethyl-4-(prop-2-ynoxymethyl)-1,3-dioxolane
(4R)-2,2-dimethyl-4-(prop-2-ynoxymethyl)-1,3-dioxolane (PubChem CID 102409102) has the molecular formula C9H14O3
and a molecular weight of 170.21 g/mol. Its IUPAC name is (4R)-2,2-dimethyl-4-(prop-2-ynoxymethyl)-1,3-dioxolane.
Molecular Properties
| Compound Name | (4R)-2,2-dimethyl-4-(prop-2-ynoxymethyl)-1,3-dioxolane |
| PubChem CID | 102409102 |
| Molecular Formula | C9H14O3 |
| Molecular Weight | 170.21 g/mol |
| Exact Mass | 170.09 |
| IUPAC Name | (4R)-2,2-dimethyl-4-(prop-2-ynoxymethyl)-1,3-dioxolane |
| SMILES | C#CCOC[C@@H]1COC(C)(C)O1 |
| InChI | InChI=1S/C9H14O3/c1-4-5-10-6-8-7-11-9(2,3)12-8/h1,8H,5-7H2,2-3H3/t8-/m1/s1 |
| InChIKey | YIHVCVPUPCJWLF-MRVPVSSYSA-N |
| XLogP | 0.79 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.21 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze (4R)-2,2-dimethyl-4-(prop-2-ynoxymethyl)-1,3-dioxolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4R)-2,2-dimethyl-4-(prop-2-ynoxymethyl)-1,3-dioxolane?
The IUPAC name of (4R)-2,2-dimethyl-4-(prop-2-ynoxymethyl)-1,3-dioxolane (CID 102409102) is (4R)-2,2-dimethyl-4-(prop-2-ynoxymethyl)-1,3-dioxolane.
What is the SMILES notation for (4R)-2,2-dimethyl-4-(prop-2-ynoxymethyl)-1,3-dioxolane?
The canonical SMILES for (4R)-2,2-dimethyl-4-(prop-2-ynoxymethyl)-1,3-dioxolane is C#CCOC[C@@H]1COC(C)(C)O1.
What is the InChIKey of (4R)-2,2-dimethyl-4-(prop-2-ynoxymethyl)-1,3-dioxolane?
The InChIKey is YIHVCVPUPCJWLF-MRVPVSSYSA-N. The full InChI is InChI=1S/C9H14O3/c1-4-5-10-6-8-7-11-9(2,3)12-8/h1,8H,5-7H2,2-3H3/t8-/m1/s1.
What are the key properties of (4R)-2,2-dimethyl-4-(prop-2-ynoxymethyl)-1,3-dioxolane?
(4R)-2,2-dimethyl-4-(prop-2-ynoxymethyl)-1,3-dioxolane has a molecular weight of 170.21 g/mol, XLogP of 0.79, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4R)-2,2-dimethyl-4-(prop-2-ynoxymethyl)-1,3-dioxolane is sourced from PubChem (CID 102409102), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).