C12H18O3 — CID 9442589
(4S)-4-(hex-5-en-2-ynoxymethyl)-2,2-dimethyl-1,3-dioxolane (PubChem CID 9442589) has the molecular formula C12H18O3 and a molecular weight of 210.27 g/mol. Its IUPAC name is (4S)-4-(hex-5-en-2-ynoxymethyl)-2,2-dimethyl-1,3-dioxolane.
| Compound Name | (4S)-4-(hex-5-en-2-ynoxymethyl)-2,2-dimethyl-1,3-dioxolane |
|---|---|
| PubChem CID | 9442589 |
| Molecular Formula | C12H18O3 |
| Molecular Weight | 210.27 g/mol |
| Exact Mass | 210.13 |
| IUPAC Name | (4S)-4-(hex-5-en-2-ynoxymethyl)-2,2-dimethyl-1,3-dioxolane |
| SMILES | C=CCC#CCOC[C@H]1COC(C)(C)O1 |
| InChI | InChI=1S/C12H18O3/c1-4-5-6-7-8-13-9-11-10-14-12(2,3)15-11/h4,11H,1,5,8-10H2,2-3H3/t11-/m0/s1 |
| InChIKey | BXWAMBVBTJTFOZ-NSHDSACASA-N |
| XLogP | 1.73 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.27 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|