C16H34O5 — CID 159627691
4-[(2-ethoxy-3-prop-2-enoxypropoxy)methyl]-2,2-dimethyl-1,3-dioxolane;methane (PubChem CID 159627691) has the molecular formula C16H34O5 and a molecular weight of 306.44 g/mol. Its IUPAC name is 4-[(2-ethoxy-3-prop-2-enoxypropoxy)methyl]-2,2-dimethyl-1,3-dioxolane;methane.
| Compound Name | 4-[(2-ethoxy-3-prop-2-enoxypropoxy)methyl]-2,2-dimethyl-1,3-dioxolane;methane |
|---|---|
| PubChem CID | 159627691 |
| Molecular Formula | C16H34O5 |
| Molecular Weight | 306.44 g/mol |
| Exact Mass | 306.24 |
| IUPAC Name | 4-[(2-ethoxy-3-prop-2-enoxypropoxy)methyl]-2,2-dimethyl-1,3-dioxolane;methane |
| SMILES | C.C.C=CCOCC(COCC1COC(C)(C)O1)OCC |
| InChI | InChI=1S/C14H26O5.2CH4/c1-5-7-15-8-12(17-6-2)9-16-10-13-11-18-14(3,4)19-13;;/h5,12-13H,1,6-11H2,2-4H3;2*1H4 |
| InChIKey | MOSDTRAGETXTJL-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.44 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|