C37H72O11 — CID 177103576
4-[[2-butoxy-3-[2-butoxy-3-[2-butoxy-3-(2-butoxy-3-prop-2-enoxypropoxy)propoxy]propoxy]propoxy]methyl]-2,2-dimethyl-1,3-dioxolane (PubChem CID 177103576) has the molecular formula C37H72O11 and a molecular weight of 692.97 g/mol. Its IUPAC name is 4-[[2-butoxy-3-[2-butoxy-3-[2-butoxy-3-(2-butoxy-3-prop-2-enoxypropoxy)propoxy]propoxy]propoxy]methyl]-2,2-dimethyl-1,3-dioxolane.
| Compound Name | 4-[[2-butoxy-3-[2-butoxy-3-[2-butoxy-3-(2-butoxy-3-prop-2-enoxypropoxy)propoxy]propoxy]propoxy]methyl]-2,2-dimethyl-1,3-dioxolane |
|---|---|
| PubChem CID | 177103576 |
| Molecular Formula | C37H72O11 |
| Molecular Weight | 692.97 g/mol |
| Exact Mass | 692.51 |
| IUPAC Name | 4-[[2-butoxy-3-[2-butoxy-3-[2-butoxy-3-(2-butoxy-3-prop-2-enoxypropoxy)propoxy]propoxy]propoxy]methyl]-2,2-dimethyl-1,3-dioxolane |
| SMILES | C=CCOCC(COCC(COCC(COCC(COCC1COC(C)(C)O1)OCCCC)OCCCC)OCCCC)OCCCC |
| InChI | InChI=1S/C37H72O11/c1-8-13-18-43-32(22-38-17-12-5)23-39-24-33(44-19-14-9-2)25-40-26-34(45-20-15-10-3)27-41-28-35(46-21-16-11-4)29-42-30-36-31-47-37(6,7)48-36/h12,32-36H,5,8-11,13-31H2,1-4,6-7H3 |
| InChIKey | JTUQBFKLMNJSJI-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 101.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 36 |
| Heavy Atoms | 48 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.97 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|