C10H19BrO3 — CID 118624680
(4S)-4-(4-bromobutoxymethyl)-2,2-dimethyl-1,3-dioxolane (PubChem CID 118624680) has the molecular formula C10H19BrO3 and a molecular weight of 267.16 g/mol. Its IUPAC name is (4S)-4-(4-bromobutoxymethyl)-2,2-dimethyl-1,3-dioxolane.
| Compound Name | (4S)-4-(4-bromobutoxymethyl)-2,2-dimethyl-1,3-dioxolane |
|---|---|
| PubChem CID | 118624680 |
| Molecular Formula | C10H19BrO3 |
| Molecular Weight | 267.16 g/mol |
| Exact Mass | 266.05 |
| IUPAC Name | (4S)-4-(4-bromobutoxymethyl)-2,2-dimethyl-1,3-dioxolane |
| SMILES | CC1(C)OC[C@H](COCCCCBr)O1 |
| InChI | InChI=1S/C10H19BrO3/c1-10(2)13-8-9(14-10)7-12-6-4-3-5-11/h9H,3-8H2,1-2H3/t9-/m0/s1 |
| InChIKey | UZRVVXJCSJTXDA-VIFPVBQESA-N |
| XLogP | 2.33 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.16 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|