C14H28O5 — CID 91584937
4-(ethoxymethyl)-2,2-dimethyl-1,3-dioxolane;2-(propoxymethyl)oxirane (PubChem CID 91584937) has the molecular formula C14H28O5 and a molecular weight of 276.37 g/mol. Its IUPAC name is 4-(ethoxymethyl)-2,2-dimethyl-1,3-dioxolane;2-(propoxymethyl)oxirane.
| Compound Name | 4-(ethoxymethyl)-2,2-dimethyl-1,3-dioxolane;2-(propoxymethyl)oxirane |
|---|---|
| PubChem CID | 91584937 |
| Molecular Formula | C14H28O5 |
| Molecular Weight | 276.37 g/mol |
| Exact Mass | 276.19 |
| IUPAC Name | 4-(ethoxymethyl)-2,2-dimethyl-1,3-dioxolane;2-(propoxymethyl)oxirane |
| SMILES | CCCOCC1CO1.CCOCC1COC(C)(C)O1 |
| InChI | InChI=1S/C8H16O3.C6H12O2/c1-4-9-5-7-6-10-8(2,3)11-7;1-2-3-7-4-6-5-8-6/h7H,4-6H2,1-3H3;6H,2-5H2,1H3 |
| InChIKey | HIRBIDFGVTXHCY-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 49.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.37 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|