C19H36O5Si — CID 10809321
(2R)-1-[2-[[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methoxy]ethoxy]-5-triethylsilylpent-4-yn-2-ol (PubChem CID 10809321) has the molecular formula C19H36O5Si and a molecular weight of 372.58 g/mol. Its IUPAC name is (2R)-1-[2-[[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methoxy]ethoxy]-5-triethylsilylpent-4-yn-2-ol.
| Compound Name | (2R)-1-[2-[[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methoxy]ethoxy]-5-triethylsilylpent-4-yn-2-ol |
|---|---|
| PubChem CID | 10809321 |
| Molecular Formula | C19H36O5Si |
| Molecular Weight | 372.58 g/mol |
| Exact Mass | 372.23 |
| IUPAC Name | (2R)-1-[2-[[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methoxy]ethoxy]-5-triethylsilylpent-4-yn-2-ol |
| SMILES | CC[Si](C#CC[C@@H](O)COCCOC[C@@H]1COC(C)(C)O1)(CC)CC |
| InChI | InChI=1S/C19H36O5Si/c1-6-25(7-2,8-3)13-9-10-17(20)14-21-11-12-22-15-18-16-23-19(4,5)24-18/h17-18,20H,6-8,10-12,14-16H2,1-5H3/t17-,18-/m1/s1 |
| InChIKey | ABUCPRRHDALBJO-QZTJIDSGSA-N |
| XLogP | 2.97 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.58 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|