C13H25BrO2 — CID 15540488
(4R)-4-(8-bromooctyl)-2,2-dimethyl-1,3-dioxolane (PubChem CID 15540488) has the molecular formula C13H25BrO2 and a molecular weight of 293.25 g/mol. Its IUPAC name is (4R)-4-(8-bromooctyl)-2,2-dimethyl-1,3-dioxolane.
| Compound Name | (4R)-4-(8-bromooctyl)-2,2-dimethyl-1,3-dioxolane |
|---|---|
| PubChem CID | 15540488 |
| Molecular Formula | C13H25BrO2 |
| Molecular Weight | 293.25 g/mol |
| Exact Mass | 292.10 |
| IUPAC Name | (4R)-4-(8-bromooctyl)-2,2-dimethyl-1,3-dioxolane |
| SMILES | CC1(C)OC[C@@H](CCCCCCCCBr)O1 |
| InChI | InChI=1S/C13H25BrO2/c1-13(2)15-11-12(16-13)9-7-5-3-4-6-8-10-14/h12H,3-11H2,1-2H3/t12-/m1/s1 |
| InChIKey | KZUKQLHWENYPMU-GFCCVEGCSA-N |
| XLogP | 4.26 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.25 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|