C14H25BrO4 — CID 10688302
(2,2-dimethyl-1,3-dioxolan-4-yl)methyl 8-bromooctanoate (PubChem CID 10688302) has the molecular formula C14H25BrO4 and a molecular weight of 337.25 g/mol. Its IUPAC name is (2,2-dimethyl-1,3-dioxolan-4-yl)methyl 8-bromooctanoate.
| Compound Name | (2,2-dimethyl-1,3-dioxolan-4-yl)methyl 8-bromooctanoate |
|---|---|
| PubChem CID | 10688302 |
| Molecular Formula | C14H25BrO4 |
| Molecular Weight | 337.25 g/mol |
| Exact Mass | 336.09 |
| IUPAC Name | (2,2-dimethyl-1,3-dioxolan-4-yl)methyl 8-bromooctanoate |
| SMILES | CC1(C)OCC(COC(=O)CCCCCCCBr)O1 |
| InChI | InChI=1S/C14H25BrO4/c1-14(2)18-11-12(19-14)10-17-13(16)8-6-4-3-5-7-9-15/h12H,3-11H2,1-2H3 |
| InChIKey | OBUXNQLIJYMSHE-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.25 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|