C14H26O4 — CID 11230661
(2,2-dimethyl-1,3-dioxolan-4-yl)methyl octanoate (PubChem CID 11230661) has the molecular formula C14H26O4 and a molecular weight of 258.36 g/mol. Its IUPAC name is (2,2-dimethyl-1,3-dioxolan-4-yl)methyl octanoate.
| Compound Name | (2,2-dimethyl-1,3-dioxolan-4-yl)methyl octanoate |
|---|---|
| PubChem CID | 11230661 |
| Molecular Formula | C14H26O4 |
| Molecular Weight | 258.36 g/mol |
| Exact Mass | 258.18 |
| IUPAC Name | (2,2-dimethyl-1,3-dioxolan-4-yl)methyl octanoate |
| SMILES | CCCCCCCC(=O)OCC1COC(C)(C)O1 |
| InChI | InChI=1S/C14H26O4/c1-4-5-6-7-8-9-13(15)16-10-12-11-17-14(2,3)18-12/h12H,4-11H2,1-3H3 |
| InChIKey | GLKYAJSVVULZFA-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.36 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|