About (2,2-dimethyl-1,3-dioxolan-4-yl)methyl 2-ethylsulfanylacetate
(2,2-dimethyl-1,3-dioxolan-4-yl)methyl 2-ethylsulfanylacetate (PubChem CID 144775228) has the molecular formula C10H18O4S
and a molecular weight of 234.32 g/mol. Its IUPAC name is (2,2-dimethyl-1,3-dioxolan-4-yl)methyl 2-ethylsulfanylacetate.
Analyze (2,2-dimethyl-1,3-dioxolan-4-yl)methyl 2-ethylsulfanylacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,2-dimethyl-1,3-dioxolan-4-yl)methyl 2-ethylsulfanylacetate?
The IUPAC name of (2,2-dimethyl-1,3-dioxolan-4-yl)methyl 2-ethylsulfanylacetate (CID 144775228) is (2,2-dimethyl-1,3-dioxolan-4-yl)methyl 2-ethylsulfanylacetate.
What is the SMILES notation for (2,2-dimethyl-1,3-dioxolan-4-yl)methyl 2-ethylsulfanylacetate?
The canonical SMILES for (2,2-dimethyl-1,3-dioxolan-4-yl)methyl 2-ethylsulfanylacetate is CCSCC(=O)OCC1COC(C)(C)O1.
What is the InChIKey of (2,2-dimethyl-1,3-dioxolan-4-yl)methyl 2-ethylsulfanylacetate?
The InChIKey is OQIGOXUKFVRRQM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18O4S/c1-4-15-7-9(11)12-5-8-6-13-10(2,3)14-8/h8H,4-7H2,1-3H3.
What are the key properties of (2,2-dimethyl-1,3-dioxolan-4-yl)methyl 2-ethylsulfanylacetate?
(2,2-dimethyl-1,3-dioxolan-4-yl)methyl 2-ethylsulfanylacetate has a molecular weight of 234.32 g/mol, XLogP of 1.43, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2,2-dimethyl-1,3-dioxolan-4-yl)methyl 2-ethylsulfanylacetate is sourced from PubChem (CID 144775228), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).