C11H20O2 — CID 124562439
(4R)-4-hex-5-enyl-2,2-dimethyl-1,3-dioxolane (PubChem CID 124562439) has the molecular formula C11H20O2 and a molecular weight of 184.28 g/mol. Its IUPAC name is (4R)-4-hex-5-enyl-2,2-dimethyl-1,3-dioxolane.
| Compound Name | (4R)-4-hex-5-enyl-2,2-dimethyl-1,3-dioxolane |
|---|---|
| PubChem CID | 124562439 |
| Molecular Formula | C11H20O2 |
| Molecular Weight | 184.28 g/mol |
| Exact Mass | 184.15 |
| IUPAC Name | (4R)-4-hex-5-enyl-2,2-dimethyl-1,3-dioxolane |
| SMILES | C=CCCCC[C@@H]1COC(C)(C)O1 |
| InChI | InChI=1S/C11H20O2/c1-4-5-6-7-8-10-9-12-11(2,3)13-10/h4,10H,1,5-9H2,2-3H3/t10-/m1/s1 |
| InChIKey | HVQDBEDUGJLECU-SNVBAGLBSA-N |
| XLogP | 2.88 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.28 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|