C11H22O3 — CID 19391800
6-(2,2-dimethyl-1,3-dioxolan-4-yl)hexan-1-ol (PubChem CID 19391800) has the molecular formula C11H22O3 and a molecular weight of 202.29 g/mol. Its IUPAC name is 6-(2,2-dimethyl-1,3-dioxolan-4-yl)hexan-1-ol.
| Compound Name | 6-(2,2-dimethyl-1,3-dioxolan-4-yl)hexan-1-ol |
|---|---|
| PubChem CID | 19391800 |
| Molecular Formula | C11H22O3 |
| Molecular Weight | 202.29 g/mol |
| Exact Mass | 202.16 |
| IUPAC Name | 6-(2,2-dimethyl-1,3-dioxolan-4-yl)hexan-1-ol |
| SMILES | CC1(C)OCC(CCCCCCO)O1 |
| InChI | InChI=1S/C11H22O3/c1-11(2)13-9-10(14-11)7-5-3-4-6-8-12/h10,12H,3-9H2,1-2H3 |
| InChIKey | KDRCNBWIQROQAZ-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.29 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|