C12H24O3 — CID 21867
(2-heptyl-2-methyl-1,3-dioxolan-4-yl)methanol (PubChem CID 21867) has the molecular formula C12H24O3 and a molecular weight of 216.32 g/mol. Its IUPAC name is (2-heptyl-2-methyl-1,3-dioxolan-4-yl)methanol.
| Compound Name | (2-heptyl-2-methyl-1,3-dioxolan-4-yl)methanol |
|---|---|
| PubChem CID | 21867 |
| Molecular Formula | C12H24O3 |
| Molecular Weight | 216.32 g/mol |
| Exact Mass | 216.17 |
| IUPAC Name | (2-heptyl-2-methyl-1,3-dioxolan-4-yl)methanol |
| SMILES | CCCCCCCC1(C)OCC(CO)O1 |
| InChI | InChI=1S/C12H24O3/c1-3-4-5-6-7-8-12(2)14-10-11(9-13)15-12/h11,13H,3-10H2,1-2H3 |
| InChIKey | XNARJYMHDDBRQP-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.32 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|