C12H24O2 — CID 21532
2-hexyl-2,4,5-trimethyl-1,3-dioxolane (PubChem CID 21532) has the molecular formula C12H24O2 and a molecular weight of 200.32 g/mol. Its IUPAC name is 2-hexyl-2,4,5-trimethyl-1,3-dioxolane.
| Compound Name | 2-hexyl-2,4,5-trimethyl-1,3-dioxolane |
|---|---|
| PubChem CID | 21532 |
| Molecular Formula | C12H24O2 |
| Molecular Weight | 200.32 g/mol |
| Exact Mass | 200.18 |
| IUPAC Name | 2-hexyl-2,4,5-trimethyl-1,3-dioxolane |
| SMILES | CCCCCCC1(C)OC(C)C(C)O1 |
| InChI | InChI=1S/C12H24O2/c1-5-6-7-8-9-12(4)13-10(2)11(3)14-12/h10-11H,5-9H2,1-4H3 |
| InChIKey | CRGQIKDUBQRGPL-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.32 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|