About (4S)-2,2-dimethyl-4-(octylsulfanyloxymethyl)-1,3-dioxolane
(4S)-2,2-dimethyl-4-(octylsulfanyloxymethyl)-1,3-dioxolane (PubChem CID 166695399) has the molecular formula C14H28O3S
and a molecular weight of 276.44 g/mol. Its IUPAC name is (4S)-2,2-dimethyl-4-(octylsulfanyloxymethyl)-1,3-dioxolane.
Molecular Properties
| Compound Name | (4S)-2,2-dimethyl-4-(octylsulfanyloxymethyl)-1,3-dioxolane |
| PubChem CID | 166695399 |
| Molecular Formula | C14H28O3S |
| Molecular Weight | 276.44 g/mol |
| Exact Mass | 276.18 |
| IUPAC Name | (4S)-2,2-dimethyl-4-(octylsulfanyloxymethyl)-1,3-dioxolane |
| SMILES | CCCCCCCCSOC[C@@H]1COC(C)(C)O1 |
| InChI | InChI=1S/C14H28O3S/c1-4-5-6-7-8-9-10-18-16-12-13-11-15-14(2,3)17-13/h13H,4-12H2,1-3H3/t13-/m0/s1 |
| InChIKey | LFRHWDUJQRNEOF-ZDUSSCGKSA-N |
| XLogP | 4.16 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.44 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (4S)-2,2-dimethyl-4-(octylsulfanyloxymethyl)-1,3-dioxolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4S)-2,2-dimethyl-4-(octylsulfanyloxymethyl)-1,3-dioxolane?
The IUPAC name of (4S)-2,2-dimethyl-4-(octylsulfanyloxymethyl)-1,3-dioxolane (CID 166695399) is (4S)-2,2-dimethyl-4-(octylsulfanyloxymethyl)-1,3-dioxolane.
What is the SMILES notation for (4S)-2,2-dimethyl-4-(octylsulfanyloxymethyl)-1,3-dioxolane?
The canonical SMILES for (4S)-2,2-dimethyl-4-(octylsulfanyloxymethyl)-1,3-dioxolane is CCCCCCCCSOC[C@@H]1COC(C)(C)O1.
What is the InChIKey of (4S)-2,2-dimethyl-4-(octylsulfanyloxymethyl)-1,3-dioxolane?
The InChIKey is LFRHWDUJQRNEOF-ZDUSSCGKSA-N. The full InChI is InChI=1S/C14H28O3S/c1-4-5-6-7-8-9-10-18-16-12-13-11-15-14(2,3)17-13/h13H,4-12H2,1-3H3/t13-/m0/s1.
What are the key properties of (4S)-2,2-dimethyl-4-(octylsulfanyloxymethyl)-1,3-dioxolane?
(4S)-2,2-dimethyl-4-(octylsulfanyloxymethyl)-1,3-dioxolane has a molecular weight of 276.44 g/mol, XLogP of 4.16, 10 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4S)-2,2-dimethyl-4-(octylsulfanyloxymethyl)-1,3-dioxolane is sourced from PubChem (CID 166695399), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).