About (2,2-dimethyl-1,3-dioxolan-4-yl)methyl-trihexylphosphanium
(2,2-dimethyl-1,3-dioxolan-4-yl)methyl-trihexylphosphanium (PubChem CID 177451904) has the molecular formula C24H50O2P+
and a molecular weight of 401.64 g/mol. Its IUPAC name is (2,2-dimethyl-1,3-dioxolan-4-yl)methyl-trihexylphosphanium.
Molecular Properties
| Compound Name | (2,2-dimethyl-1,3-dioxolan-4-yl)methyl-trihexylphosphanium |
| PubChem CID | 177451904 |
| Molecular Formula | C24H50O2P+ |
| Molecular Weight | 401.64 g/mol |
| Exact Mass | 401.35 |
| IUPAC Name | (2,2-dimethyl-1,3-dioxolan-4-yl)methyl-trihexylphosphanium |
| SMILES | CCCCCC[P+](CCCCCC)(CCCCCC)CC1COC(C)(C)O1 |
| InChI | InChI=1S/C24H50O2P/c1-6-9-12-15-18-27(19-16-13-10-7-2,20-17-14-11-8-3)22-23-21-25-24(4,5)26-23/h23H,6-22H2,1-5H3/q+1 |
| InChIKey | KGZRIBKDZDYOJC-UHFFFAOYSA-N |
| XLogP | 7.90 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 401.64 |
| LogP ≤ 5 | 7.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze (2,2-dimethyl-1,3-dioxolan-4-yl)methyl-trihexylphosphanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,2-dimethyl-1,3-dioxolan-4-yl)methyl-trihexylphosphanium?
The IUPAC name of (2,2-dimethyl-1,3-dioxolan-4-yl)methyl-trihexylphosphanium (CID 177451904) is (2,2-dimethyl-1,3-dioxolan-4-yl)methyl-trihexylphosphanium.
What is the SMILES notation for (2,2-dimethyl-1,3-dioxolan-4-yl)methyl-trihexylphosphanium?
The canonical SMILES for (2,2-dimethyl-1,3-dioxolan-4-yl)methyl-trihexylphosphanium is CCCCCC[P+](CCCCCC)(CCCCCC)CC1COC(C)(C)O1.
What is the InChIKey of (2,2-dimethyl-1,3-dioxolan-4-yl)methyl-trihexylphosphanium?
The InChIKey is KGZRIBKDZDYOJC-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H50O2P/c1-6-9-12-15-18-27(19-16-13-10-7-2,20-17-14-11-8-3)22-23-21-25-24(4,5)26-23/h23H,6-22H2,1-5H3/q+1.
What are the key properties of (2,2-dimethyl-1,3-dioxolan-4-yl)methyl-trihexylphosphanium?
(2,2-dimethyl-1,3-dioxolan-4-yl)methyl-trihexylphosphanium has a molecular weight of 401.64 g/mol, XLogP of 7.90, 17 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2,2-dimethyl-1,3-dioxolan-4-yl)methyl-trihexylphosphanium is sourced from PubChem (CID 177451904), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).