C24H50O2P+ — CID 177451904
(2,2-dimethyl-1,3-dioxolan-4-yl)methyl-trihexylphosphanium (PubChem CID 177451904) has the molecular formula C24H50O2P+ and a molecular weight of 401.64 g/mol. Its IUPAC name is (2,2-dimethyl-1,3-dioxolan-4-yl)methyl-trihexylphosphanium.
| Compound Name | (2,2-dimethyl-1,3-dioxolan-4-yl)methyl-trihexylphosphanium |
|---|---|
| PubChem CID | 177451904 |
| Molecular Formula | C24H50O2P+ |
| Molecular Weight | 401.64 g/mol |
| Exact Mass | 401.35 |
| IUPAC Name | (2,2-dimethyl-1,3-dioxolan-4-yl)methyl-trihexylphosphanium |
| SMILES | CCCCCC[P+](CCCCCC)(CCCCCC)CC1COC(C)(C)O1 |
| InChI | InChI=1S/C24H50O2P/c1-6-9-12-15-18-27(19-16-13-10-7-2,20-17-14-11-8-3)22-23-21-25-24(4,5)26-23/h23H,6-22H2,1-5H3/q+1 |
| InChIKey | KGZRIBKDZDYOJC-UHFFFAOYSA-N |
| XLogP | 7.90 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.64 |
| LogP ≤ 5 | 7.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|