C16H28O3 — CID 14705447
(E)-1-(2,2-dimethyl-1,3-dioxolan-4-yl)undec-3-en-2-one (PubChem CID 14705447) has the molecular formula C16H28O3 and a molecular weight of 268.40 g/mol. Its IUPAC name is (E)-1-(2,2-dimethyl-1,3-dioxolan-4-yl)undec-3-en-2-one.
| Compound Name | (E)-1-(2,2-dimethyl-1,3-dioxolan-4-yl)undec-3-en-2-one |
|---|---|
| PubChem CID | 14705447 |
| Molecular Formula | C16H28O3 |
| Molecular Weight | 268.40 g/mol |
| Exact Mass | 268.20 |
| IUPAC Name | (E)-1-(2,2-dimethyl-1,3-dioxolan-4-yl)undec-3-en-2-one |
| SMILES | CCCCCCC/C=C/C(=O)CC1COC(C)(C)O1 |
| InChI | InChI=1S/C16H28O3/c1-4-5-6-7-8-9-10-11-14(17)12-15-13-18-16(2,3)19-15/h10-11,15H,4-9,12-13H2,1-3H3/b11-10+ |
| InChIKey | XDPGIDJZVLINAM-ZHACJKMWSA-N |
| XLogP | 4.01 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.40 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|