C13H24O2 — CID 136670620
(4R)-4-[(Z,1R)-1,3-dideuteriooct-2-enyl]-2,2-dimethyl-1,3-dioxolane (PubChem CID 136670620) has the molecular formula C13H24O2 and a molecular weight of 214.35 g/mol. Its IUPAC name is (4R)-4-[(Z,1R)-1,3-dideuteriooct-2-enyl]-2,2-dimethyl-1,3-dioxolane.
| Compound Name | (4R)-4-[(Z,1R)-1,3-dideuteriooct-2-enyl]-2,2-dimethyl-1,3-dioxolane |
|---|---|
| PubChem CID | 136670620 |
| Molecular Formula | C13H24O2 |
| Molecular Weight | 214.35 g/mol |
| Exact Mass | 214.19 |
| IUPAC Name | (4R)-4-[(Z,1R)-1,3-dideuteriooct-2-enyl]-2,2-dimethyl-1,3-dioxolane |
| SMILES | [2H]/C(=C/[C@@H]([2H])[C@@H]1COC(C)(C)O1)CCCCC |
| InChI | InChI=1S/C13H24O2/c1-4-5-6-7-8-9-10-12-11-14-13(2,3)15-12/h8-9,12H,4-7,10-11H2,1-3H3/b9-8-/t12-/m1/s1/i8D,10D/t10-,12- |
| InChIKey | XPSSKMQVXXBJJI-AVZBFJQMSA-N |
| XLogP | 3.66 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.35 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|