C27H48O2S2 — CID 10895963
4-[[2-[(8Z,11Z)-heptadeca-8,11-dienyl]-1,3-dithian-2-yl]methyl]-2,2-dimethyl-1,3-dioxolane (PubChem CID 10895963) has the molecular formula C27H48O2S2 and a molecular weight of 468.81 g/mol. Its IUPAC name is 4-[[2-[(8Z,11Z)-heptadeca-8,11-dienyl]-1,3-dithian-2-yl]methyl]-2,2-dimethyl-1,3-dioxolane.
| Compound Name | 4-[[2-[(8Z,11Z)-heptadeca-8,11-dienyl]-1,3-dithian-2-yl]methyl]-2,2-dimethyl-1,3-dioxolane |
|---|---|
| PubChem CID | 10895963 |
| Molecular Formula | C27H48O2S2 |
| Molecular Weight | 468.81 g/mol |
| Exact Mass | 468.31 |
| IUPAC Name | 4-[[2-[(8Z,11Z)-heptadeca-8,11-dienyl]-1,3-dithian-2-yl]methyl]-2,2-dimethyl-1,3-dioxolane |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCC1(CC2COC(C)(C)O2)SCCCS1 |
| InChI | InChI=1S/C27H48O2S2/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-20-27(30-21-19-22-31-27)23-25-24-28-26(2,3)29-25/h8-9,11-12,25H,4-7,10,13-24H2,1-3H3/b9-8-,12-11- |
| InChIKey | AQIGNFXEDLMXGV-MURFETPASA-N |
| XLogP | 8.91 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.81 |
| LogP ≤ 5 | 8.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|