C41H72O3 — CID 70807768
2-[2-[(6Z,9Z)-octadeca-6,9-dienyl]-2-[(6Z,9Z,12Z)-octadeca-6,9,12-trienyl]-1,3-dioxolan-4-yl]ethanol (PubChem CID 70807768) has the molecular formula C41H72O3 and a molecular weight of 613.02 g/mol. Its IUPAC name is 2-[2-[(6Z,9Z)-octadeca-6,9-dienyl]-2-[(6Z,9Z,12Z)-octadeca-6,9,12-trienyl]-1,3-dioxolan-4-yl]ethanol.
| Compound Name | 2-[2-[(6Z,9Z)-octadeca-6,9-dienyl]-2-[(6Z,9Z,12Z)-octadeca-6,9,12-trienyl]-1,3-dioxolan-4-yl]ethanol |
|---|---|
| PubChem CID | 70807768 |
| Molecular Formula | C41H72O3 |
| Molecular Weight | 613.02 g/mol |
| Exact Mass | 612.55 |
| IUPAC Name | 2-[2-[(6Z,9Z)-octadeca-6,9-dienyl]-2-[(6Z,9Z,12Z)-octadeca-6,9,12-trienyl]-1,3-dioxolan-4-yl]ethanol |
| SMILES | CCCCC/C=C\C/C=C\C/C=C\CCCCCC1(CCCCC/C=C\C/C=C\CCCCCCCC)OCC(CCO)O1 |
| InChI | InChI=1S/C41H72O3/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-36-41(43-39-40(44-41)35-38-42)37-34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-4-2/h11,13,17-20,23-26,40,42H,3-10,12,14-16,21-22,27-39H2,1-2H3/b13-11-,19-17-,20-18-,25-23-,26-24- |
| InChIKey | QRPMYORTQZLDQQ-GZRJAJFZSA-N |
| XLogP | 12.66 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 31 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.02 |
| LogP ≤ 5 | 12.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|