C44H79NO2 — CID 58559621
1-[2-[2,2-bis[(9Z,12Z)-octadeca-9,12-dienyl]-1,3-dioxolan-4-yl]ethyl]-2-methylaziridine (PubChem CID 58559621) has the molecular formula C44H79NO2 and a molecular weight of 654.12 g/mol. Its IUPAC name is 1-[2-[2,2-bis[(9Z,12Z)-octadeca-9,12-dienyl]-1,3-dioxolan-4-yl]ethyl]-2-methylaziridine.
| Compound Name | 1-[2-[2,2-bis[(9Z,12Z)-octadeca-9,12-dienyl]-1,3-dioxolan-4-yl]ethyl]-2-methylaziridine |
|---|---|
| PubChem CID | 58559621 |
| Molecular Formula | C44H79NO2 |
| Molecular Weight | 654.12 g/mol |
| Exact Mass | 653.61 |
| IUPAC Name | 1-[2-[2,2-bis[(9Z,12Z)-octadeca-9,12-dienyl]-1,3-dioxolan-4-yl]ethyl]-2-methylaziridine |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCC1(CCCCCCCC/C=C\C/C=C\CCCCC)OCC(CCN2CC2C)O1 |
| InChI | InChI=1S/C44H79NO2/c1-4-6-8-10-12-14-16-18-20-22-24-26-28-30-32-34-37-44(46-41-43(47-44)36-39-45-40-42(45)3)38-35-33-31-29-27-25-23-21-19-17-15-13-11-9-7-5-2/h12-15,18-21,42-43H,4-11,16-17,22-41H2,1-3H3/b14-12-,15-13-,20-18-,21-19- |
| InChIKey | VEMHONULKBHNCG-QYCRHRGJSA-N |
| XLogP | 13.60 |
| TPSA | 21.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 33 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.12 |
| LogP ≤ 5 | 13.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|