C41H74O2 — CID 134393906
2-[(9Z,12Z)-icosa-9,12-dienyl]-2-[(5Z,8Z)-pentadeca-5,8-dienyl]-4-propyl-1,3-dioxolane (PubChem CID 134393906) has the molecular formula C41H74O2 and a molecular weight of 599.04 g/mol. Its IUPAC name is 2-[(9Z,12Z)-icosa-9,12-dienyl]-2-[(5Z,8Z)-pentadeca-5,8-dienyl]-4-propyl-1,3-dioxolane.
| Compound Name | 2-[(9Z,12Z)-icosa-9,12-dienyl]-2-[(5Z,8Z)-pentadeca-5,8-dienyl]-4-propyl-1,3-dioxolane |
|---|---|
| PubChem CID | 134393906 |
| Molecular Formula | C41H74O2 |
| Molecular Weight | 599.04 g/mol |
| Exact Mass | 598.57 |
| IUPAC Name | 2-[(9Z,12Z)-icosa-9,12-dienyl]-2-[(5Z,8Z)-pentadeca-5,8-dienyl]-4-propyl-1,3-dioxolane |
| SMILES | CCCCCC/C=C\C/C=C\CCCCC1(CCCCCCCC/C=C\C/C=C\CCCCCCC)OCC(CCC)O1 |
| InChI | InChI=1S/C41H74O2/c1-4-7-9-11-13-15-17-19-20-21-22-23-25-27-29-31-33-35-38-41(42-39-40(43-41)36-6-3)37-34-32-30-28-26-24-18-16-14-12-10-8-5-2/h16-19,21-22,26,28,40H,4-15,20,23-25,27,29-39H2,1-3H3/b18-16-,19-17-,22-21-,28-26- |
| InChIKey | UQEAKUXJPHOSLK-MFLRZQOSSA-N |
| XLogP | 13.92 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 31 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.04 |
| LogP ≤ 5 | 13.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|