C45H84INO2 — CID 89440930
2-[2,2-bis[(9Z,12Z)-octadeca-9,12-dienyl]-1,3-dioxolan-4-yl]ethyl-ethyl-dimethylazanium iodide (PubChem CID 89440930) has the molecular formula C45H84INO2 and a molecular weight of 798.08 g/mol. Its IUPAC name is 2-[2,2-bis[(9Z,12Z)-octadeca-9,12-dienyl]-1,3-dioxolan-4-yl]ethyl-ethyl-dimethylazanium iodide.
| Compound Name | 2-[2,2-bis[(9Z,12Z)-octadeca-9,12-dienyl]-1,3-dioxolan-4-yl]ethyl-ethyl-dimethylazanium iodide |
|---|---|
| PubChem CID | 89440930 |
| Molecular Formula | C45H84INO2 |
| Molecular Weight | 798.08 g/mol |
| Exact Mass | 797.55 |
| IUPAC Name | 2-[2,2-bis[(9Z,12Z)-octadeca-9,12-dienyl]-1,3-dioxolan-4-yl]ethyl-ethyl-dimethylazanium iodide |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCC1(CCCCCCCC/C=C\C/C=C\CCCCC)OCC(CC[N+](C)(C)CC)O1.[I-] |
| InChI | InChI=1S/C45H84NO2.HI/c1-6-9-11-13-15-17-19-21-23-25-27-29-31-33-35-37-40-45(47-43-44(48-45)39-42-46(4,5)8-3)41-38-36-34-32-30-28-26-24-22-20-18-16-14-12-10-7-2;/h15-18,21-24,44H,6-14,19-20,25-43H2,1-5H3;1H/q+1;/p-1/b17-15-,18-16-,23-21-,24-22-; |
| InChIKey | XWJXMALGVKGJFH-YIHZIEOQSA-M |
| XLogP | 11.00 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 34 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 798.08 |
| LogP ≤ 5 | 11.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|