C44H81NO2 — CID 171042821
3-[2,2-bis[(9E,12E)-octadeca-9,12-dienyl]-1,3-dioxolan-4-yl]-N,N-dimethylpropan-1-amine (PubChem CID 171042821) has the molecular formula C44H81NO2 and a molecular weight of 656.14 g/mol. Its IUPAC name is 3-[2,2-bis[(9E,12E)-octadeca-9,12-dienyl]-1,3-dioxolan-4-yl]-N,N-dimethylpropan-1-amine.
| Compound Name | 3-[2,2-bis[(9E,12E)-octadeca-9,12-dienyl]-1,3-dioxolan-4-yl]-N,N-dimethylpropan-1-amine |
|---|---|
| PubChem CID | 171042821 |
| Molecular Formula | C44H81NO2 |
| Molecular Weight | 656.14 g/mol |
| Exact Mass | 655.63 |
| IUPAC Name | 3-[2,2-bis[(9E,12E)-octadeca-9,12-dienyl]-1,3-dioxolan-4-yl]-N,N-dimethylpropan-1-amine |
| SMILES | CCCCC/C=C/C/C=C/CCCCCCCCC1(CCCCCCCC/C=C/C/C=C/CCCCC)OCC(CCCN(C)C)O1 |
| InChI | InChI=1S/C44H81NO2/c1-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-35-39-44(46-42-43(47-44)38-37-41-45(3)4)40-36-34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-2/h13-16,19-22,43H,5-12,17-18,23-42H2,1-4H3/b15-13+,16-14+,21-19+,22-20+ |
| InChIKey | HNTKPUXXCNQLFR-SKHCUOGJSA-N |
| XLogP | 13.85 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 34 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.14 |
| LogP ≤ 5 | 13.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|