C45H82N2O2 — CID 58473230
1-[[2,2-bis[(9Z,12Z)-octadeca-9,12-dienyl]-1,3-dioxolan-4-yl]methyl]-4-methylpiperazine (PubChem CID 58473230) has the molecular formula C45H82N2O2 and a molecular weight of 683.16 g/mol. Its IUPAC name is 1-[[2,2-bis[(9Z,12Z)-octadeca-9,12-dienyl]-1,3-dioxolan-4-yl]methyl]-4-methylpiperazine.
| Compound Name | 1-[[2,2-bis[(9Z,12Z)-octadeca-9,12-dienyl]-1,3-dioxolan-4-yl]methyl]-4-methylpiperazine |
|---|---|
| PubChem CID | 58473230 |
| Molecular Formula | C45H82N2O2 |
| Molecular Weight | 683.16 g/mol |
| Exact Mass | 682.64 |
| IUPAC Name | 1-[[2,2-bis[(9Z,12Z)-octadeca-9,12-dienyl]-1,3-dioxolan-4-yl]methyl]-4-methylpiperazine |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCC1(CCCCCCCC/C=C\C/C=C\CCCCC)OCC(CN2CCN(C)CC2)O1 |
| InChI | InChI=1S/C45H82N2O2/c1-4-6-8-10-12-14-16-18-20-22-24-26-28-30-32-34-36-45(48-43-44(49-45)42-47-40-38-46(3)39-41-47)37-35-33-31-29-27-25-23-21-19-17-15-13-11-9-7-5-2/h12-15,18-21,44H,4-11,16-17,22-43H2,1-3H3/b14-12-,15-13-,20-18-,21-19- |
| InChIKey | LGGPJISBZWWFCO-QYCRHRGJSA-N |
| XLogP | 12.75 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 32 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 683.16 |
| LogP ≤ 5 | 12.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|