C21H38O4 — CID 123626139
2-heptadeca-8,11-dienyl-4-(hydroxymethyl)-1,3-dioxolan-2-ol (PubChem CID 123626139) has the molecular formula C21H38O4 and a molecular weight of 354.53 g/mol. Its IUPAC name is 2-heptadeca-8,11-dienyl-4-(hydroxymethyl)-1,3-dioxolan-2-ol.
| Compound Name | 2-heptadeca-8,11-dienyl-4-(hydroxymethyl)-1,3-dioxolan-2-ol |
|---|---|
| PubChem CID | 123626139 |
| Molecular Formula | C21H38O4 |
| Molecular Weight | 354.53 g/mol |
| Exact Mass | 354.28 |
| IUPAC Name | 2-heptadeca-8,11-dienyl-4-(hydroxymethyl)-1,3-dioxolan-2-ol |
| SMILES | CCCCCC=CCC=CCCCCCCCC1(O)OCC(CO)O1 |
| InChI | InChI=1S/C21H38O4/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-21(23)24-19-20(18-22)25-21/h6-7,9-10,20,22-23H,2-5,8,11-19H2,1H3 |
| InChIKey | UHSWLJQKXSYPER-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.53 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|