C18H36O3 — CID 58883730
(2-methyl-2-tridecyl-1,3-dioxolan-4-yl)methanol (PubChem CID 58883730) has the molecular formula C18H36O3 and a molecular weight of 300.48 g/mol. Its IUPAC name is (2-methyl-2-tridecyl-1,3-dioxolan-4-yl)methanol.
| Compound Name | (2-methyl-2-tridecyl-1,3-dioxolan-4-yl)methanol |
|---|---|
| PubChem CID | 58883730 |
| Molecular Formula | C18H36O3 |
| Molecular Weight | 300.48 g/mol |
| Exact Mass | 300.27 |
| IUPAC Name | (2-methyl-2-tridecyl-1,3-dioxolan-4-yl)methanol |
| SMILES | CCCCCCCCCCCCCC1(C)OCC(CO)O1 |
| InChI | InChI=1S/C18H36O3/c1-3-4-5-6-7-8-9-10-11-12-13-14-18(2)20-16-17(15-19)21-18/h17,19H,3-16H2,1-2H3 |
| InChIKey | SNIFEISHWOGSKH-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.48 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|