C15H29NO4 — CID 76959250
[(2S,4S)-2-methyl-2-nonyl-1,3-dioxolan-4-yl]methyl carbamate (PubChem CID 76959250) has the molecular formula C15H29NO4 and a molecular weight of 287.40 g/mol. Its IUPAC name is [(2S,4S)-2-methyl-2-nonyl-1,3-dioxolan-4-yl]methyl carbamate.
| Compound Name | [(2S,4S)-2-methyl-2-nonyl-1,3-dioxolan-4-yl]methyl carbamate |
|---|---|
| PubChem CID | 76959250 |
| Molecular Formula | C15H29NO4 |
| Molecular Weight | 287.40 g/mol |
| Exact Mass | 287.21 |
| IUPAC Name | [(2S,4S)-2-methyl-2-nonyl-1,3-dioxolan-4-yl]methyl carbamate |
| SMILES | CCCCCCCCC[C@@]1(C)OC[C@@H](COC(N)=O)O1 |
| InChI | InChI=1S/C15H29NO4/c1-3-4-5-6-7-8-9-10-15(2)19-12-13(20-15)11-18-14(16)17/h13H,3-12H2,1-2H3,(H2,16,17)/t13-,15+/m1/s1 |
| InChIKey | OWCAKKIRPJUQFO-HIFRSBDPSA-N |
| XLogP | 3.35 |
| TPSA | 70.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.40 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|