C18H37O7P — CID 139440420
3-[[2-methyl-4-(nonoxymethyl)-1,3-dioxolan-2-yl]methoxy]propylphosphonic acid (PubChem CID 139440420) has the molecular formula C18H37O7P and a molecular weight of 396.46 g/mol. Its IUPAC name is 3-[[2-methyl-4-(nonoxymethyl)-1,3-dioxolan-2-yl]methoxy]propylphosphonic acid.
| Compound Name | 3-[[2-methyl-4-(nonoxymethyl)-1,3-dioxolan-2-yl]methoxy]propylphosphonic acid |
|---|---|
| PubChem CID | 139440420 |
| Molecular Formula | C18H37O7P |
| Molecular Weight | 396.46 g/mol |
| Exact Mass | 396.23 |
| IUPAC Name | 3-[[2-methyl-4-(nonoxymethyl)-1,3-dioxolan-2-yl]methoxy]propylphosphonic acid |
| SMILES | CCCCCCCCCOCC1COC(C)(COCCCP(=O)(O)O)O1 |
| InChI | InChI=1S/C18H37O7P/c1-3-4-5-6-7-8-9-11-22-14-17-15-24-18(2,25-17)16-23-12-10-13-26(19,20)21/h17H,3-16H2,1-2H3,(H2,19,20,21) |
| InChIKey | ANJZLWRAKWXVFM-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 94.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.46 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|