C22H42O8 — CID 58971744
4-[4-[(2-hydroxy-2-pentyl-1,3-dioxolan-4-yl)methoxy]butoxymethyl]-2-pentyl-1,3-dioxolan-2-ol (PubChem CID 58971744) has the molecular formula C22H42O8 and a molecular weight of 434.57 g/mol. Its IUPAC name is 4-[4-[(2-hydroxy-2-pentyl-1,3-dioxolan-4-yl)methoxy]butoxymethyl]-2-pentyl-1,3-dioxolan-2-ol.
| Compound Name | 4-[4-[(2-hydroxy-2-pentyl-1,3-dioxolan-4-yl)methoxy]butoxymethyl]-2-pentyl-1,3-dioxolan-2-ol |
|---|---|
| PubChem CID | 58971744 |
| Molecular Formula | C22H42O8 |
| Molecular Weight | 434.57 g/mol |
| Exact Mass | 434.29 |
| IUPAC Name | 4-[4-[(2-hydroxy-2-pentyl-1,3-dioxolan-4-yl)methoxy]butoxymethyl]-2-pentyl-1,3-dioxolan-2-ol |
| SMILES | CCCCCC1(O)OCC(COCCCCOCC2COC(O)(CCCCC)O2)O1 |
| InChI | InChI=1S/C22H42O8/c1-3-5-7-11-21(23)27-17-19(29-21)15-25-13-9-10-14-26-16-20-18-28-22(24,30-20)12-8-6-4-2/h19-20,23-24H,3-18H2,1-2H3 |
| InChIKey | YLIPZWMSBBIKSQ-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 95.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.57 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|