C20H26N2O8 — CID 171400383
1-[3-[[2-[3-(2,5-dioxopyrrol-1-yl)propoxymethyl]-2-methyl-1,3-dioxolan-4-yl]methoxy]propyl]pyrrole-2,5-dione (PubChem CID 171400383) has the molecular formula C20H26N2O8 and a molecular weight of 422.43 g/mol. Its IUPAC name is 1-[3-[[2-[3-(2,5-dioxopyrrol-1-yl)propoxymethyl]-2-methyl-1,3-dioxolan-4-yl]methoxy]propyl]pyrrole-2,5-dione.
| Compound Name | 1-[3-[[2-[3-(2,5-dioxopyrrol-1-yl)propoxymethyl]-2-methyl-1,3-dioxolan-4-yl]methoxy]propyl]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 171400383 |
| Molecular Formula | C20H26N2O8 |
| Molecular Weight | 422.43 g/mol |
| Exact Mass | 422.17 |
| IUPAC Name | 1-[3-[[2-[3-(2,5-dioxopyrrol-1-yl)propoxymethyl]-2-methyl-1,3-dioxolan-4-yl]methoxy]propyl]pyrrole-2,5-dione |
| SMILES | CC1(COCCCN2C(=O)C=CC2=O)OCC(COCCCN2C(=O)C=CC2=O)O1 |
| InChI | InChI=1S/C20H26N2O8/c1-20(14-28-11-3-9-22-18(25)6-7-19(22)26)29-13-15(30-20)12-27-10-2-8-21-16(23)4-5-17(21)24/h4-7,15H,2-3,8-14H2,1H3 |
| InChIKey | GICIUTDCPHMRDC-UHFFFAOYSA-N |
| XLogP | -0.22 |
| TPSA | 111.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.43 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|